On Target RT_HIV1 0.38157895/CHEMBL4291913
For the given ligand Rilpivirine, we have found in our database that, being scored 0.38157895, the most similar ligand is CHEMBL4291913. Check out the elaboration below.
| Rilpivirine (Given Ligand) | CHEMBL4291913 (Similar Ligand) |
|---|---|
| Cc1cc(/C=C/C#N)cc(C)c1Nc3ccnc(Nc2ccc(C#N)cc2)n3 | O=c1cc(Nc2cccc(-c3ccc(Cl)cc3)c2)[nH]c(=O)n1O |
|
|
|
|
|
|
| 00000202 00000800 00000100 08090620 02000029 00004000 8000a090 00000cc0 00002100 00800840 00300004 41029000 04000000 00008000 00020042 000c000c 00440400 12004000 08c0000a 10a00000 40080000 0c040000 21804c40 00400000 00000000 80000000 02402100 400110c0 0048c008 00660c00 44000000 000020c0 | 0100a002 00400000 00000108 4a090600 00000000 00004100 00009010 40000800 06002100 00000870 04300004 40049800 07008004 004000c0 002000c0 000c0414 00060040 1201c000 0c40000a 10200000 41802000 08060100 30804040 00d00000 00042000 c0080000 22040240 000400e0 0040c008 00460000 40000000 010200c0 |