On Target NS5B_HCV1B 0.23849373/CHEMBL3645207
For the given ligand Rilpivirine, we have found in our database that, being scored 0.23849373, the most similar ligand is CHEMBL3645207. Check out the elaboration below.
| Rilpivirine (Given Ligand) | CHEMBL3645207 (Similar Ligand) |
|---|---|
| Cc1cc(/C=C/C#N)cc(C)c1Nc3ccnc(Nc2ccc(C#N)cc2)n3 | CNC(=O)c1c2cc(C3CC3)c(N(CCCO)S(C)(=O)=O)cc2nn1-c1ccc(Nc2ccccc2F)cc1 |
|
|
|
|
|
|
| 00000202 00000800 00000100 08090620 02000029 00004000 8000a090 00000cc0 00002100 00800840 00300004 41029000 04000000 00008000 00020042 000c000c 00440400 12004000 08c0000a 10a00000 40080000 0c040000 21804c40 00400000 00000000 80000000 02402100 400110c0 0048c008 00660c00 44000000 000020c0 | 00004006 00805e0c 20180b06 43390e00 210c0000 00004052 02040010 0200140c 00102900 004908c0 09312024 40118800 80008c23 01401201 810a0040 000e200e 04268400 02400004 08e0000a 00224205 c0100101 1c878e38 21800880 9360001c 02104080 c0000040 02270080 8000108d 0c488104 0046804b c4048080 a01147e0 |