On Target NP_HCoV-OC43 0.18562874/CHEMBL3233481
For the given ligand Nelfinavir, we have found in our database that, being scored 0.18562874, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Nelfinavir (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| Cc1c(O)cccc1C(=O)N[C@@H](CSc2ccccc2)[C@H](O)CN4C[C@H]3CCCC[C@H]3C[C@H]4C(=O)NC(C)(C)C | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00010008 45805e08 20120100 1c110600 00000080 80008000 02000000 22001000 04000000 020049e0 00600000 7005b000 0601880a 00242102 86180400 20082008 14000000 02000000 02006000 00020301 80020000 390a8610 03800501 0654001d 00002000 c0000000 00004200 90000010 08001100 00060011 b0064000 03012220 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |