On Target PLP_SARS 0.36787564/CHEMBL213054
For the given ligand Saquinavir, we have found in our database that, being scored 0.36787564, the most similar ligand is CHEMBL213054. Check out the elaboration below.
| Saquinavir (Given Ligand) | CHEMBL213054 (Similar Ligand) |
|---|---|
| CC(C)(C)NC(=O)[C@@H]2C[C@@H]1CCCC[C@@H]1CN2C[C@@H](O)[C@H](Cc3ccccc3)NC(=O)[C@H](CC(N)=O)NC(=O)c5ccc4ccccc4n5 | CC(OC(C)(C)C)[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CC1CCCCC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00038002 01007c00 00104102 14010e00 000400a0 00100000 00000000 2200300d 00300880 000909e0 08390004 5003b000 0e00880a 00702002 801a0440 020c010c 10000000 02000003 02602010 00000201 40000100 382b8618 23802041 8350001c 00101000 c0000000 00000040 90000000 0c000106 00060013 a0064000 00806600 | 01030000 01407000 00100100 84010600 00040080 0023c010 00000000 20000008 00a00300 000208c0 00200000 4003b000 1e00801a 00092001 80001008 021a0008 00220000 02080400 02802890 01000201 00000020 38040e30 13000083 02500018 00000401 80002002 00800800 10200020 08000200 00060001 e0024000 00802200 |