On Target NS3_HCV1A 0.46231157/CHEMBL3645762
For the given ligand Indinavir, we have found in our database that, being scored 0.46231157, the most similar ligand is CHEMBL3645762. Check out the elaboration below.
| Indinavir (Given Ligand) | CHEMBL3645762 (Similar Ligand) |
|---|---|
| CC(C)(C)NC(=O)[C@@H]2CN(Cc1cccnc1)CCN2C[C@@H](O)C[C@@H](Cc3ccccc3)C(=O)N[C@H]5c4ccccc4C[C@H]5O | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@]2(CN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)c1cnc3ccccc3c1)C1CCCCC1)C(C)(C)C)C(C)(C)C21CCC1)C(=O)NS(=O)(=O)N1CCCC1 |
|
|
|
|
|
|
| 1005000a 0180d600 00104902 14010610 001c10c0 00000000 00004000 22001000 00000800 000909e0 09300004 4001b000 0e008892 00203003 801c0480 000e000c 18020000 02000004 00602018 00000201 c0020100 38048e30 23804023 02500018 00041800 c0000000 08004000 90000000 08400102 0006081b 20044000 80002e00 | 100180a2 0980b800 06104100 05210610 00041000 00000010 000a4000 22001408 10000000 0011c9c8 01602004 4001b000 0601881a 01402011 a0400440 00040004 04024000 02000004 46212000 00004201 c0000000 38068e38 20800003 b2d0003c 00040000 c0000000 08000000 90000010 08400100 c0060081 e4064004 80012260 |