On Target NS3_HCV1A 0.43601894/CHEMBL3645643
For the given ligand Delavirdine, we have found in our database that, being scored 0.43601894, the most similar ligand is CHEMBL3645643. Check out the elaboration below.
| Delavirdine (Given Ligand) | CHEMBL3645643 (Similar Ligand) |
|---|---|
| CC(C)Nc1cccnc1N4CCN(C(=O)c3cc2cc(NS(C)(=O)=O)ccc2[nH]3)CC4 | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@]2(CN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)c1cccc(N(C)C)n1)C1CCCCC1)C(C)(C)C)C(C)(C)C21CCC1)C(=O)NS(=O)(=O)N1CCCC1 |
|
|
|
|
|
|
| 00004002 0080a800 00004123 14310e20 00040020 08100000 00000000 02203009 00000000 20010ac0 00292004 40008000 00008c02 00502001 800e0441 02160104 00040000 0200400e 08200000 00a04004 40100000 2e068e08 20802820 8260001e 00100082 c0100000 00000480 8000008c 0840811c 00460801 80041200 000142e0 | 000180a2 09003800 06104100 15200e00 01040020 00100010 008a0000 22003409 10000800 0019c1c8 00692004 40013000 0601881a 01102011 a0420400 02040104 04044000 02004002 4e212000 00a04201 40000000 3c07a630 20802803 32f0003c 00100000 c0000000 000000e0 90000090 0840810c c2060881 e4064004 00016260 |