On Target NS3_HCV1B 0.495/CHEMBL3954962
For the given ligand Indinavir, we have found in our database that, being scored 0.495, the most similar ligand is CHEMBL3954962. Check out the elaboration below.
| Indinavir (Given Ligand) | CHEMBL3954962 (Similar Ligand) |
|---|---|
| CC(C)(C)NC(=O)[C@@H]2CN(Cc1cccnc1)CCN2C[C@@H](O)C[C@@H](Cc3ccccc3)C(=O)N[C@H]5c4ccccc4C[C@H]5O | C=CC(=O)NC[C@H](NC(=O)[C@@H](NC(=O)c1cnccn1)C1CCCCC1)C(=O)N1C[C@@H]2CCC[C@@H]2[C@H]1C(=O)N[C@@H](CCC)C(OC(=O)C(F)(F)F)C(=O)NC1CC1 |
|
|
|
|
|
|
| 1005000a 0180d600 00104902 14010610 001c10c0 00000000 00004000 22001000 00000800 000909e0 09300004 4001b000 0e008892 00203003 801c0480 000e000c 18020000 02000004 00602018 00000201 c0020100 38048e30 23804023 02500018 00041800 c0000000 08004000 90000000 08400102 0006081b 20044000 80002e00 | 10018002 01807400 00100b00 94010f10 000800c0 00100010 0000c00c 20003409 11000000 000101a0 01290000 4001f000 0e00801a 01112001 809a1408 000c110c 18860000 82000103 02402010 00001205 80000120 300f8e30 33004003 0250001c 00141400 00000000 08880000 90000005 08000204 01060813 a4024000 82002600 |