On Target PA_INFA 0.2862191/CHEMBL2040640
For the given ligand Paritaprevir, we have found in our database that, being scored 0.2862191, the most similar ligand is CHEMBL2040640. Check out the elaboration below.
| Paritaprevir (Given Ligand) | CHEMBL2040640 (Similar Ligand) |
|---|---|
| Cc8cnc(C(=O)N[C@H]7CCCCC/C=C\[C@@H]1C[C@@]1(C(=O)NS(=O)(=O)C2CC2)NC(=O)[C@@H]6C[C@@H](Oc4nc3ccccc3c5ccccc45)CN6C7=O)cn8 | O=C(O)/C(O)=C/C(=O)C1(Cc2ccc(Cl)cc2)CCCN(S(=O)(=O)Cc2ccccc2)C1 |
|
|
|
|
|
|
| 1405a082 0d807018 20104908 15310f12 841410c0 02118110 060ac000 2000340b 10010200 005188d8 012d2404 4101b000 0682c81a 09542003 b1da15c1 001ca10c 1a224000 02000142 40e12000 02024201 c0020040 bc178e38 33a0c083 b2140138 02340001 00000000 08c04200 9000000d 0c000204 80060c81 a4064000 85012a70 | 00018000 05000220 00102102 01310600 00000000 00000000 00000084 28008400 11000800 007808c4 08302418 5001d800 8e029036 00240001 80400400 000c0008 0000400c 02000100 00252018 00004a01 80000100 1c800b90 04008000 10500030 02003800 80002400 00444000 9000000c 04004002 0006008a 24000000 00032670 |