On Target RT_HIV1 0.25543478/CHEMBL4291913
For the given ligand Lamivudine, we have found in our database that, being scored 0.25543478, the most similar ligand is CHEMBL4291913. Check out the elaboration below.
| Lamivudine (Given Ligand) | CHEMBL4291913 (Similar Ligand) |
|---|---|
| Nc2ccn([C@@H]1CS[C@H](CO)O1)c(=O)n2 | O=c1cc(Nc2cccc(-c3ccc(Cl)cc3)c2)[nH]c(=O)n1O |
|
|
|
|
|
|
| 00000002 40400000 20000001 88180640 04080040 00006000 40009400 00000910 04000100 010040b0 0410900c 40059004 00009000 21dc0010 05a05080 001c100c 04240006 00200000 00402000 00201000 80080000 18000000 25800241 08600800 00030400 40000012 00000200 90003060 00000209 01460000 c0280000 060100c0 | 0100a002 00400000 00000108 4a090600 00000000 00004100 00009010 40000800 06002100 00000870 04300004 40049800 07008004 004000c0 002000c0 000c0414 00060040 1201c000 0c40000a 10200000 41802000 08060100 30804040 00d00000 00042000 c0080000 22040240 000400e0 0040c008 00460000 40000000 010200c0 |