On Target NS5B_HCV1A 0.50877196/CHEMBL13256
For the given ligand Indinavir, we have found in our database that, being scored 0.50877196, the most similar ligand is CHEMBL13256. Check out the elaboration below.
| Indinavir (Given Ligand) | CHEMBL13256 (Similar Ligand) |
|---|---|
| CC(C)(C)NC(=O)[C@@H]2CN(Cc1cccnc1)CCN2C[C@@H](O)C[C@@H](Cc3ccccc3)C(=O)N[C@H]5c4ccccc4C[C@H]5O | CC[C@H](NC(=O)[C@H](CC1CCCCC1)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)c1cnccn1)[C@@H](C)CC)C(=O)C(=O)NCC(=O)O |
|
|
|
|
|
|
| 1005000a 0180d600 00104902 14010610 001c10c0 00000000 00004000 22001000 00000800 000909e0 09300004 4001b000 0e008892 00203003 801c0480 000e000c 18020000 02000004 00602018 00000201 c0020100 38048e30 23804023 02500018 00041800 c0000000 08004000 90000000 08400102 0006081b 20044000 80002e00 | 10018002 01807400 00100800 14000c10 000000c0 00100000 0000c000 20003009 14000000 000101a0 01292000 40013000 0e00800a 00102003 808a0400 000c010c 18020000 02000003 02002010 00000201 80000000 300f8e10 23004003 02100018 00141000 00000000 08000000 90000004 08000004 00060811 a0024000 80002200 |