On Target NS5B_HCV1A 0.31764707/CHEMBL3644907
For the given ligand Delavirdine, we have found in our database that, being scored 0.31764707, the most similar ligand is CHEMBL3644907. Check out the elaboration below.
| Delavirdine (Given Ligand) | CHEMBL3644907 (Similar Ligand) |
|---|---|
| CC(C)Nc1cccnc1N4CCN(C(=O)c3cc2cc(NS(C)(=O)=O)ccc2[nH]3)CC4 | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1CN(c2ccc(-n3cccn3)cc2)CN1C(=O)[C@@H](NC(=O)OC1CCCC1)C(C)(C)C)C(=O)NS(=O)(=O)C1CC1 |
|
|
|
|
|
|
| 00004002 0080a800 00004123 14310e20 00040020 08100000 00000000 02203009 00000000 20010ac0 00292004 40008000 00008c02 00502001 800e0441 02160104 00040000 0200400e 08200000 00a04004 40100000 2e068e08 20802820 8260001e 00100082 c0100000 00000480 8000008c 0840811c 00460801 80041200 000142e0 | 00014086 0d403608 20100120 05390f00 20080000 0001c000 000a0004 a000340d 10800300 00538be8 01202404 5001b000 0e00f802 01042101 80420440 001e800c 02864010 00482000 48610850 00224a01 60100100 bc058e30 21820803 b304003a 02112000 00001002 00000000 902000ac 0c008200 8146009b e41c4000 810166f0 |