On Target NS5B_HCV1B 0.40163934/CHEMBL3645200
For the given ligand Indinavir, we have found in our database that, being scored 0.40163934, the most similar ligand is CHEMBL3645200. Check out the elaboration below.
| Indinavir (Given Ligand) | CHEMBL3645200 (Similar Ligand) |
|---|---|
| CC(C)(C)NC(=O)[C@@H]2CN(Cc1cccnc1)CCN2C[C@@H](O)C[C@@H](Cc3ccccc3)C(=O)N[C@H]5c4ccccc4C[C@H]5O | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)c3cccnc3)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 1005000a 0180d600 00104902 14010610 001c10c0 00000000 00004000 22001000 00000800 000909e0 09300004 4001b000 0e008892 00203003 801c0480 000e000c 18020000 02000004 00602018 00000201 c0020100 38048e30 23804023 02500018 00041800 c0000000 08004000 90000000 08400102 0006081b 20044000 80002e00 | 10004006 0080de08 20184902 41310e10 210c1000 00004042 02044000 02001408 00100900 004909e0 09312024 40118800 80008c33 01400201 808a0440 000e200e 04268000 02000004 08600008 00225203 e0100101 1c8f8e38 2080c800 9360001c 02144080 c0000048 08270080 8000108c 0c488104 0046005b e4048088 a81147e0 |