On Target NS5B_HCV1B 0.427907/CHEMBL3645203
For the given ligand Delavirdine, we have found in our database that, being scored 0.427907, the most similar ligand is CHEMBL3645203. Check out the elaboration below.
| Delavirdine (Given Ligand) | CHEMBL3645203 (Similar Ligand) |
|---|---|
| CC(C)Nc1cccnc1N4CCN(C(=O)c3cc2cc(NS(C)(=O)=O)ccc2[nH]3)CC4 | CNC(=O)c1c2cc(C3CC3)c(N(C)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 00004002 0080a800 00004123 14310e20 00040020 08100000 00000000 02203009 00000000 20010ac0 00292004 40008000 00008c02 00502001 800e0441 02160104 00040000 0200400e 08200000 00a04004 40100000 2e068e08 20802820 8260001e 00100082 c0100000 00000480 8000008c 0840811c 00460801 80041200 000142e0 | 00004006 0080de08 20080902 40310e00 010c0000 00004002 02040000 02001408 00100900 000908c0 09312024 40118800 80008c33 01400201 800a0040 000e200c 04268000 02000004 08600008 00224201 c0000101 1c838e38 2080c800 8360001c 00104080 c0000040 00270080 8000108c 0c408104 0046004b c4048088 a81147e0 |