On Target NA_INFB 0.16111112/CHEMBL183817
For the given ligand Lamivudine, we have found in our database that, being scored 0.16111112, the most similar ligand is CHEMBL183817. Check out the elaboration below.
| Lamivudine (Given Ligand) | CHEMBL183817 (Similar Ligand) |
|---|---|
| Nc2ccn([C@@H]1CS[C@H](CO)O1)c(=O)n2 | COC(=O)[C@@H]1C[C@H](C(=O)O)O[C@H]1[C@H](CC(C)C)NC(C)=O |
|
|
|
|
|
|
| 00000002 40400000 20000001 88180640 04080040 00006000 40009400 00000910 04000100 010040b0 0410900c 40059004 00009000 21dc0010 05a05080 001c100c 04240006 00200000 00402000 00201000 80080000 18000000 25800241 08600800 00030400 40000012 00000200 90003060 00000209 01460000 c0280000 060100c0 | 00070040 01005000 00100000 80010500 003c00c0 00200000 00000000 20000000 00000000 01020080 00200000 4001d000 1400802a 03800000 00081008 18099008 10820000 80000100 11402000 00000201 00000020 10040e10 17000000 0810001c 10000400 00000000 00800200 10000021 00000200 00040001 00020000 00800a00 |