On Target NA_INFB 0.3888889/CHEMBL369125
For the given ligand Indinavir, we have found in our database that, being scored 0.3888889, the most similar ligand is CHEMBL369125. Check out the elaboration below.
| Indinavir (Given Ligand) | CHEMBL369125 (Similar Ligand) |
|---|---|
| CC(C)(C)NC(=O)[C@@H]2CN(Cc1cccnc1)CCN2C[C@@H](O)C[C@@H](Cc3ccccc3)C(=O)N[C@H]5c4ccccc4C[C@H]5O | COC(=O)[C@@H]1C[C@H](C(=O)O)N[C@H]1[C@H](CC(C)C)NC(C)=O |
|
|
|
|
|
|
| 1005000a 0180d600 00104902 14010610 001c10c0 00000000 00004000 22001000 00000800 000909e0 09300004 4001b000 0e008892 00203003 801c0480 000e000c 18020000 02000004 00602018 00000201 c0020100 38048e30 23804023 02500018 00041800 c0000000 08004000 90000000 08400102 0006081b 20044000 80002e00 | 00030000 01003000 00100100 04010500 00180080 00000010 00000000 20000008 00000000 00020080 00200000 4001b000 0e00803a 03802001 80180000 00080008 10a20000 00000000 00c02010 00000201 00000000 30040e30 03000081 02100018 00001001 00000000 00000200 10000000 08000200 00040001 00024000 00802a00 |