On Target NA_INFB 0.24454148/CHEMBL4175983
For the given ligand Delavirdine, we have found in our database that, being scored 0.24454148, the most similar ligand is CHEMBL4175983. Check out the elaboration below.
| Delavirdine (Given Ligand) | CHEMBL4175983 (Similar Ligand) |
|---|---|
| CC(C)Nc1cccnc1N4CCN(C(=O)c3cc2cc(NS(C)(=O)=O)ccc2[nH]3)CC4 | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NCc2ccc(N3CCCC3)cc2)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 00004002 0080a800 00004123 14310e20 00040020 08100000 00000000 02203009 00000000 20010ac0 00292004 40008000 00008c02 00502001 800e0441 02160104 00040000 0200400e 08200000 00a04004 40100000 2e068e08 20802820 8260001e 00100082 c0100000 00000480 8000008c 0840811c 00460801 80041200 000142e0 | 00074042 09007800 00100100 84010700 20180080 00002810 02080180 3a00140a 11000000 001108c8 40200004 41019001 0402881a 0188a000 00021448 00081008 10a44000 02000060 68c12010 00000201 40100020 38048e80 33008080 02500018 10001401 c0001400 00c04000 90000081 0c008300 00060401 24060000 00800a10 |