On Target NP_HCoV-OC43 0.23353294/CHEMBL3233481
For the given ligand Indinavir, we have found in our database that, being scored 0.23353294, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Indinavir (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CC(C)(C)NC(=O)[C@@H]2CN(Cc1cccnc1)CCN2C[C@@H](O)C[C@@H](Cc3ccccc3)C(=O)N[C@H]5c4ccccc4C[C@H]5O | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 1005000a 0180d600 00104902 14010610 001c10c0 00000000 00004000 22001000 00000800 000909e0 09300004 4001b000 0e008892 00203003 801c0480 000e000c 18020000 02000004 00602018 00000201 c0020100 38048e30 23804023 02500018 00041800 c0000000 08004000 90000000 08400102 0006081b 20044000 80002e00 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |