On Target NP_HCoV-OC43 0.34228188/CHEMBL3233481
For the given ligand Delavirdine, we have found in our database that, being scored 0.34228188, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Delavirdine (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CC(C)Nc1cccnc1N4CCN(C(=O)c3cc2cc(NS(C)(=O)=O)ccc2[nH]3)CC4 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00004002 0080a800 00004123 14310e20 00040020 08100000 00000000 02203009 00000000 20010ac0 00292004 40008000 00008c02 00502001 800e0441 02160104 00040000 0200400e 08200000 00a04004 40100000 2e068e08 20802820 8260001e 00100082 c0100000 00000480 8000008c 0840811c 00460801 80041200 000142e0 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |