On Target PLP_SARS 0.35416666/CHEMBL213054
For the given ligand Indinavir, we have found in our database that, being scored 0.35416666, the most similar ligand is CHEMBL213054. Check out the elaboration below.
| Indinavir (Given Ligand) | CHEMBL213054 (Similar Ligand) |
|---|---|
| CC(C)(C)NC(=O)[C@@H]2CN(Cc1cccnc1)CCN2C[C@@H](O)C[C@@H](Cc3ccccc3)C(=O)N[C@H]5c4ccccc4C[C@H]5O | CC(OC(C)(C)C)[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CC1CCCCC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 1005000a 0180d600 00104902 14010610 001c10c0 00000000 00004000 22001000 00000800 000909e0 09300004 4001b000 0e008892 00203003 801c0480 000e000c 18020000 02000004 00602018 00000201 c0020100 38048e30 23804023 02500018 00041800 c0000000 08004000 90000000 08400102 0006081b 20044000 80002e00 | 01030000 01407000 00100100 84010600 00040080 0023c010 00000000 20000008 00a00300 000208c0 00200000 4003b000 1e00801a 00092001 80001008 021a0008 00220000 02080400 02802890 01000201 00000020 38040e30 13000083 02500018 00000401 80002002 00800800 10200020 08000200 00060001 e0024000 00802200 |