On Target PLP_SARS 0.354067/CHEMBL213054
For the given ligand Atazanavir, we have found in our database that, being scored 0.354067, the most similar ligand is CHEMBL213054. Check out the elaboration below.
| Atazanavir (Given Ligand) | CHEMBL213054 (Similar Ligand) |
|---|---|
| COC(=O)N[C@H](C(=O)N[C@@H](Cc1ccccc1)[C@@H](O)CN(Cc3ccc(c2ccccn2)cc3)NC(=O)[C@@H](NC(=O)OC)C(C)(C)C)C(C)(C)C | CC(OC(C)(C)C)[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CC1CCCCC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 0000200e 09007400 00106142 14010600 000401a0 00018000 00010000 2208101c 03900b80 50080de8 0830801c 4001b000 8c008802 00202000 201a0480 021e000c 10020000 02082000 04700010 10400201 c0000100 38288e10 73814041 83500018 00000000 c0000002 10000040 90000060 0d004304 004e0413 a0044800 00042688 | 01030000 01407000 00100100 84010600 00040080 0023c010 00000000 20000008 00a00300 000208c0 00200000 4003b000 1e00801a 00092001 80001008 021a0008 00220000 02080400 02802890 01000201 00000020 38040e30 13000083 02500018 00000401 80002002 00800800 10200020 08000200 00060001 e0024000 00802200 |