On Target NS3_HCV1A 0.2874016/CHEMBL3891173
For the given ligand Efavirenz, we have found in our database that, being scored 0.2874016, the most similar ligand is CHEMBL3891173. Check out the elaboration below.
| Efavirenz (Given Ligand) | CHEMBL3891173 (Similar Ligand) |
|---|---|
| O=C3Nc1ccc(Cl)cc1[C@@](C#CC2CC2)(C(F)(F)F)O3 | CC(C)c1ccc2c(Nc3cc(NC(=O)[C@@H]4CCCN4C(=O)OCc4ccccc4)ccc3Sc3ccc(N)cc3)ncnc2n1 |
|
|
|
|
|
|
| 01008202 94400008 00100100 00011200 00402000 00006020 04200001 00000200 00000304 40080844 082804a4 42009808 0e028004 01310001 80020040 42392008 00168480 02c00400 0a040890 00400801 60000208 08000d30 2000a002 00f00110 00002000 80402102 00080014 90001088 00808200 81060003 40000884 22020600 | 0101400a 01c03a00 001a4120 1c190600 2c040020 0001e010 00009810 00000808 10802300 00080ac0 08389004 6081b810 0e008812 00912000 80020040 1a1e000e 04061000 72084400 0860089a 12200201 c0100000 38048e70 20806041 8258001f 00084000 80102202 022084d0 10a000a0 08c0820c 01460003 e000c000 200106e0 |