On Target NS3_HCV1B 0.3761468/CHEMBL3921185
For the given ligand Peramivir, we have found in our database that, being scored 0.3761468, the most similar ligand is CHEMBL3921185. Check out the elaboration below.
| Peramivir (Given Ligand) | CHEMBL3921185 (Similar Ligand) |
|---|---|
| CCC(CC)[C@H](NC(C)=O)[C@H]1[C@H](NC(=N)N)C[C@H](C(=O)O)[C@H]1O | C=CC(=O)NC[C@H](NC(=O)NC(C)(C)C)C(=O)N1CC2[C@@H]([C@H]1C(=O)NC(CC1CCC1)C(=O)C(N)=O)C2(C)C |
|
|
|
|
|
|
| 00030000 01001400 00100000 00000c00 00180000 00000000 00000000 20002000 00000200 000001a2 00200000 40011000 1400901a 01800000 00000000 00180008 00000000 00000000 01c02000 00000201 00000000 101d2e10 01000080 00100018 00000003 00000000 40000000 10000000 00000010 01040011 801a0000 00800a00 | 00010000 01003400 00100000 04000c00 00000000 00000010 00000004 20002408 05000000 000201a0 00200000 50013000 0e00a01a 01012011 80000000 00000000 00000010 00000101 00002050 00001201 00000100 300d0630 00000003 02100018 00001000 00000000 00080000 10000000 08000000 00040011 24024000 02002200 |