On Target PA_INFA 0.24657534/CHEMBL2040578
For the given ligand Valaciclovir, we have found in our database that, being scored 0.24657534, the most similar ligand is CHEMBL2040578. Check out the elaboration below.
| Valaciclovir (Given Ligand) | CHEMBL2040578 (Similar Ligand) |
|---|---|
| CC(C)[C@H](N)C(=O)OCCOCn2cnc1c(=O)nc(N)[nH]c12 | CC(NC(=O)c1nc(-c2cnccn2)[nH]c(=O)c1O)c1ccccc1 |
|
|
|
|
|
|
| 0000000a 00c01800 00080408 80010700 00080040 0000c100 0000bc04 00000840 06402100 810000f0 0c00800c 4000b010 04009000 00480000 00081080 101d900c 00220020 00008000 10400000 00201001 80080120 1c000a40 27800840 08300814 00000400 c0200002 60000200 10040060 00004208 00461000 c0200000 80000280 | 00000202 00811808 40000100 10050e10 00000068 00124006 00c09800 0a003405 16000100 40180860 08290004 40048810 00008802 00708003 00820400 000c200c 08002068 1200b022 80c00000 10400000 80000000 48008600 21800040 4050011c 00044806 c0000680 28000030 80041004 0000410c 07660c03 c4048000 500006a0 |