On Target PA_INFA 0.25698325/CHEMBL2040554
For the given ligand Efavirenz, we have found in our database that, being scored 0.25698325, the most similar ligand is CHEMBL2040554. Check out the elaboration below.
| Efavirenz (Given Ligand) | CHEMBL2040554 (Similar Ligand) |
|---|---|
| O=C3Nc1ccc(Cl)cc1[C@@](C#CC2CC2)(C(F)(F)F)O3 | O=C(O)/C(O)=C/C(=O)C1(Cc2ccc(Cl)cc2)CCN(CC2CCCCC2)CC1 |
|
|
|
|
|
|
| 01008202 94400008 00100100 00011200 00402000 00006020 04200001 00000200 00000304 40080844 082804a4 42009808 0e028004 01310001 80020040 42392008 00168480 02c00400 0a040890 00400801 60000208 08000d30 2000a002 00f00110 00002000 80402102 00080014 90001088 00808200 81060003 40000884 22020600 | 00028000 01000000 00100102 00010600 00000000 00000000 00000080 28000400 01100800 001808c0 08300000 5001d800 86028026 00200000 00000400 00080008 00000000 02000000 02252018 00000201 00000100 18000b90 04008000 00500010 00003800 80002400 00444000 90000000 00004000 00060002 04020000 00822600 |