On Target RT_HIV1 0.31007752/CHEMBL3828596
For the given ligand Peramivir, we have found in our database that, being scored 0.31007752, the most similar ligand is CHEMBL3828596. Check out the elaboration below.
| Peramivir (Given Ligand) | CHEMBL3828596 (Similar Ligand) |
|---|---|
| CCC(CC)[C@H](NC(C)=O)[C@H]1[C@H](NC(=N)N)C[C@H](C(=O)O)[C@H]1O | C=C(C)[C@@H]1CC[C@]2(CNCCCN3CCCC3=O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00030000 01001400 00100000 00000c00 00180000 00000000 00000000 20002000 00000200 000001a2 00200000 40011000 1400901a 01800000 00000000 00180008 00000000 00000000 01c02000 00000201 00000000 101d2e10 01000080 00100018 00000003 00000000 40000000 10000000 00000010 01040011 801a0000 00800a00 | 00020000 01001c00 00100302 40050600 00000000 00004010 80000080 20000402 00000900 001809e0 08300000 40019800 04028002 00200000 00000402 00080008 00000400 02000020 02012000 00000201 01000100 180a0e30 00008020 0050001c 01200000 80000000 00406000 d0000000 00400002 01060013 e4020000 00802600 |