On Target NS5B_HCV1A 0.42857143/CHEMBL13443
For the given ligand Peramivir, we have found in our database that, being scored 0.42857143, the most similar ligand is CHEMBL13443. Check out the elaboration below.
| Peramivir (Given Ligand) | CHEMBL13443 (Similar Ligand) |
|---|---|
| CCC(CC)[C@H](NC(C)=O)[C@H]1[C@H](NC(=N)N)C[C@H](C(=O)O)[C@H]1O | C=CCNC(=O)C(=O)[C@H](CC)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](N)CC(=O)O)C(C)C)C(C)C |
|
|
|
|
|
|
| 00030000 01001400 00100000 00000c00 00180000 00000000 00000000 20002000 00000200 000001a2 00200000 40011000 1400901a 01800000 00000000 00180008 00000000 00000000 01c02000 00000201 00000000 101d2e10 01000080 00100018 00000003 00000000 40000000 10000000 00000010 01040011 801a0000 00800a00 | 00070000 01003400 00100000 04000400 00180000 00000010 00000000 20000408 04000000 000201a0 00200800 40013000 0e008032 01012001 80000000 00080008 00000000 00000101 00c00010 00000201 00000000 300c0e20 01000003 02100018 00001000 00000000 00080000 10000000 08000002 00040011 2c004000 02802a00 |