On Target NS5B_HCV1A 0.27319586/CHEMBL348944
For the given ligand Efavirenz, we have found in our database that, being scored 0.27319586, the most similar ligand is CHEMBL348944. Check out the elaboration below.
| Efavirenz (Given Ligand) | CHEMBL348944 (Similar Ligand) |
|---|---|
| O=C3Nc1ccc(Cl)cc1[C@@](C#CC2CC2)(C(F)(F)F)O3 | CCC(C)[C@H](NC(=O)OCc1ccc(C(=O)O)cc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(F)F)C(=O)C(=O)O |
|
|
|
|
|
|
| 01008202 94400008 00100100 00011200 00402000 00006020 04200001 00000200 00000304 40080844 082804a4 42009808 0e028004 01310001 80020040 42392008 00168480 02c00400 0a040890 00400801 60000208 08000d30 2000a002 00f00110 00002000 80402102 00080014 90001088 00808200 81060003 40000884 22020600 | 01010000 01403800 00100100 44050600 00081000 0001c000 00000000 20000008 04800300 000008c0 00200000 4001f000 0e008002 00012001 80000000 021a0408 000a0000 02080401 00c00890 00000201 00000000 38160e70 01000083 0250001c 00001001 80002082 00000060 90200020 08000200 02060001 e0004000 00002200 |