On Target NS5B_HCV1B 0.1882353/CHEMBL4111989
For the given ligand Cidofovir, we have found in our database that, being scored 0.1882353, the most similar ligand is CHEMBL4111989. Check out the elaboration below.
| Cidofovir (Given Ligand) | CHEMBL4111989 (Similar Ligand) |
|---|---|
| Nc1ccn(C[C@@H](CO)OCP(=O)(O)O)c(=O)n1 | C[C@@]1(C#N)[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@H]1c1ccc2c(N)ncnn12 |
|
|
|
|
|
|
| 00000002 00100800 80000000 48080600 00080061 00004100 00009002 00000800 0400010a 808000a0 0400080c 40019000 00009000 00c20000 00201080 600e400c 00200028 00000000 10c00000 00200000 80000180 1d400010 27800041 0c600010 00000000 40000000 00000200 08014030 00000208 00460000 40080000 000080c4 | 0000080a 81004009 e2401512 19010f20 050c8074 0012c024 0381c000 00200a80 1040cb00 010c0040 08108004 4a839040 00000802 02b30020 000e0040 020cba0c 094b8820 0680000e 01602008 00665203 40100121 2c008860 a5801cc6 08600110 40000400 80002102 060880c0 800508a0 0040020e 00c6cc16 41400280 6220ac82 |