On Target NS5B_HCV1B 0.37423313/CHEMBL3645214
For the given ligand Velpatasvir, we have found in our database that, being scored 0.37423313, the most similar ligand is CHEMBL3645214. Check out the elaboration below.
| Velpatasvir (Given Ligand) | CHEMBL3645214 (Similar Ligand) |
|---|---|
| COC[C@H]9C[C@@H](c7ncc(c1ccc6c(c1)COc5cc4c(ccc3nc([C@@H]2CC[C@H](C)N2C(=O)[C@@H](NC(=O)OC)C(C)C)[nH]c34)cc56)[nH]7)N(C(=O)[C@H](NC(=O)OC)c8ccccc8)C9 | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)C3CCOC3)S(C)(=O)=O)cc2nn1-c1ccc(Nc2ccc(F)cc2)cc1 |
|
|
|
|
|
|
| 0400a00a 01803809 20100d08 94010f10 001c1061 0811c01a 07480000 220a3049 00800380 004808d0 09218004 4081b800 0f808886 08712000 61020041 821e210c 00a28000 0608b022 04e02018 500a0a01 c0300008 38378e38 31802081 83d0501c 00146001 80082002 10000248 900010e8 0c034305 10e60803 e0046aa4 20006e80 | 00044006 00805e08 20180902 43390f00 211c0000 00204052 02040010 2200140c 00102900 004909e0 09312024 40119800 94008c23 01481201 808a0040 000e200e 04268000 02000104 08e0000a 00225203 e0100121 1c8f8e38 21800880 9360001c 02104481 c0000048 02270280 9000108d 0c488304 0046805b c4048080 a0116fe0 |