On Target NP_HCoV-OC43 0.13380282/CHEMBL3233481
For the given ligand Cidofovir, we have found in our database that, being scored 0.13380282, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Cidofovir (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| Nc1ccn(C[C@@H](CO)OCP(=O)(O)O)c(=O)n1 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00000002 00100800 80000000 48080600 00080061 00004100 00009002 00000800 0400010a 808000a0 0400080c 40019000 00009000 00c20000 00201080 600e400c 00200028 00000000 10c00000 00200000 80000180 1d400010 27800041 0c600010 00000000 40000000 00000200 08014030 00000208 00460000 40080000 000080c4 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |