On Target NP_HCoV-OC43 0.17063493/CHEMBL3233481
For the given ligand Velpatasvir, we have found in our database that, being scored 0.17063493, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Velpatasvir (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| COC[C@H]9C[C@@H](c7ncc(c1ccc6c(c1)COc5cc4c(ccc3nc([C@@H]2CC[C@H](C)N2C(=O)[C@@H](NC(=O)OC)C(C)C)[nH]c34)cc56)[nH]7)N(C(=O)[C@H](NC(=O)OC)c8ccccc8)C9 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 0400a00a 01803809 20100d08 94010f10 001c1061 0811c01a 07480000 220a3049 00800380 004808d0 09218004 4081b800 0f808886 08712000 61020041 821e210c 00a28000 0608b022 04e02018 500a0a01 c0300008 38378e38 31802081 83d0501c 00146001 80082002 10000248 900010e8 0c034305 10e60803 e0046aa4 20006e80 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |