On Target PLP_SARS 0.3219697/CHEMBL213054
For the given ligand Velpatasvir, we have found in our database that, being scored 0.3219697, the most similar ligand is CHEMBL213054. Check out the elaboration below.
| Velpatasvir (Given Ligand) | CHEMBL213054 (Similar Ligand) |
|---|---|
| COC[C@H]9C[C@@H](c7ncc(c1ccc6c(c1)COc5cc4c(ccc3nc([C@@H]2CC[C@H](C)N2C(=O)[C@@H](NC(=O)OC)C(C)C)[nH]c34)cc56)[nH]7)N(C(=O)[C@H](NC(=O)OC)c8ccccc8)C9 | CC(OC(C)(C)C)[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CC1CCCCC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 0400a00a 01803809 20100d08 94010f10 001c1061 0811c01a 07480000 220a3049 00800380 004808d0 09218004 4081b800 0f808886 08712000 61020041 821e210c 00a28000 0608b022 04e02018 500a0a01 c0300008 38378e38 31802081 83d0501c 00146001 80082002 10000248 900010e8 0c034305 10e60803 e0046aa4 20006e80 | 01030000 01407000 00100100 84010600 00040080 0023c010 00000000 20000008 00a00300 000208c0 00200000 4003b000 1e00801a 00092001 80001008 021a0008 00220000 02080400 02802890 01000201 00000020 38040e30 13000083 02500018 00000401 80002002 00800800 10200020 08000200 00060001 e0024000 00802200 |