On Target PLP_SARS 0.23076923/CHEMBL213054
For the given ligand Valaciclovir, we have found in our database that, being scored 0.23076923, the most similar ligand is CHEMBL213054. Check out the elaboration below.
| Valaciclovir (Given Ligand) | CHEMBL213054 (Similar Ligand) |
|---|---|
| CC(C)[C@H](N)C(=O)OCCOCn2cnc1c(=O)nc(N)[nH]c12 | CC(OC(C)(C)C)[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CC1CCCCC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 0000000a 00c01800 00080408 80010700 00080040 0000c100 0000bc04 00000840 06402100 810000f0 0c00800c 4000b010 04009000 00480000 00081080 101d900c 00220020 00008000 10400000 00201001 80080120 1c000a40 27800840 08300814 00000400 c0200002 60000200 10040060 00004208 00461000 c0200000 80000280 | 01030000 01407000 00100100 84010600 00040080 0023c010 00000000 20000008 00a00300 000208c0 00200000 4003b000 1e00801a 00092001 80001008 021a0008 00220000 02080400 02802890 01000201 00000020 38040e30 13000083 02500018 00000401 80002002 00800800 10200020 08000200 00060001 e0024000 00802200 |