On Target PLP_SARS 0.28019324/CHEMBL213543
For the given ligand Efavirenz, we have found in our database that, being scored 0.28019324, the most similar ligand is CHEMBL213543. Check out the elaboration below.
| Efavirenz (Given Ligand) | CHEMBL213543 (Similar Ligand) |
|---|---|
| O=C3Nc1ccc(Cl)cc1[C@@](C#CC2CC2)(C(F)(F)F)O3 | CCOC(=O)/C=C/[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)C |
|
|
|
|
|
|
| 01008202 94400008 00100100 00011200 00402000 00006020 04200001 00000200 00000304 40080844 082804a4 42009808 0e028004 01310001 80020040 42392008 00168480 02c00400 0a040890 00400801 60000208 08000d30 2000a002 00f00110 00002000 80402102 00080014 90001088 00808200 81060003 40000884 22020600 | 01030000 0140b000 00100100 04010600 00000000 0001c810 02100080 28000408 01a00300 001088c0 40200000 4003b000 0e028002 00012001 80000400 021a0008 20020000 02080500 20012890 00001201 00002000 38040fb0 00008003 02500018 00001400 8800ac02 00484000 90200120 08000200 00060001 ec004000 02802210 |