On Target NSP1_SARS 0.14659686/CHEMBL2441745
For the given ligand Cidofovir, we have found in our database that, being scored 0.14659686, the most similar ligand is CHEMBL2441745. Check out the elaboration below.
| Cidofovir (Given Ligand) | CHEMBL2441745 (Similar Ligand) |
|---|---|
| Nc1ccn(C[C@@H](CO)OCP(=O)(O)O)c(=O)n1 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(=O)C(=O)NC(C)C |
|
|
|
|
|
|
| 00000002 00100800 80000000 48080600 00080061 00004100 00009002 00000800 0400010a 808000a0 0400080c 40019000 00009000 00c20000 00201080 600e400c 00200028 00000000 10c00000 00200000 80000180 1d400010 27800041 0c600010 00000000 40000000 00000200 08014030 00000208 00460000 40080000 000080c4 | 01030000 01403600 00100100 04010600 00000000 0001c010 00000000 2000000c 04e00b00 000a09e0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080401 00002898 00000201 00000100 382c0e38 00000003 83500018 00001800 80002002 00000000 10200020 0c000200 0006001b e0024000 00802600 |