On Target NSP1_SARS 0.28865978/CHEMBL2441741
For the given ligand Efavirenz, we have found in our database that, being scored 0.28865978, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| Efavirenz (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| O=C3Nc1ccc(Cl)cc1[C@@](C#CC2CC2)(C(F)(F)F)O3 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 01008202 94400008 00100100 00011200 00402000 00006020 04200001 00000200 00000304 40080844 082804a4 42009808 0e028004 01310001 80020040 42392008 00168480 02c00400 0a040890 00400801 60000208 08000d30 2000a002 00f00110 00002000 80402102 00080014 90001088 00808200 81060003 40000884 22020600 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |