On Target NS3_HCV1B 0.4929078/CHEMBL1170410
For the given ligand Asunaprevir, we have found in our database that, being scored 0.4929078, the most similar ligand is CHEMBL1170410. Check out the elaboration below.
| Asunaprevir (Given Ligand) | CHEMBL1170410 (Similar Ligand) |
|---|---|
| C=C[C@@H]1C[C@]1(NC(=O)[C@@H]4C[C@@H](Oc2ncc(OC)c3ccc(Cl)cc23)CN4C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)C(=O)NS(=O)(=O)C5CC5 | C=CCCCCS(=O)(=O)NC(=O)[C@H](CCC)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)c1ccc(Oc2cc(-c3ccccc3)nc3cc(OC)ccc23)c(C=C)c1 |
|
|
|
|
|
|
| 0405a082 0d407018 60104108 05310702 80141080 02018114 160a0000 20201428 10810200 005088c8 00242404 4005b800 0e80c81e 09442003 b1581541 001ea00c 12224000 00080500 40e10810 00024201 40020040 bc148f38 33a00083 b2148038 02002401 00000002 00980200 9020802d 08000200 80060081 a4044000 07032a70 | 08012082 65c03008 20104108 15310600 00241023 00018080 96060080 22081408 00800284 105988c0 08202404 4003b000 0f00c802 00442001 c1420541 025ea00c 02020040 02082004 04282810 00465a01 c0400000 bc248e19 30800103 b3440038 02000000 c0000002 08322048 9020406c 0c404384 00260403 a4067c00 01252670 |