On Target NS3_HCV1B 0.16115703/CHEMBL3954962
For the given ligand Tenofovir disoproxil, we have found in our database that, being scored 0.16115703, the most similar ligand is CHEMBL3954962. Check out the elaboration below.
| Tenofovir disoproxil (Given Ligand) | CHEMBL3954962 (Similar Ligand) |
|---|---|
| CC(C)OC(=O)OCOP(=O)(CO[C@H](C)Cn2cnc1c(N)ncnc12)OCOC(=O)OC(C)C | C=CC(=O)NC[C@H](NC(=O)[C@@H](NC(=O)c1cnccn1)C1CCCCC1)C(=O)N1C[C@@H]2CCC[C@@H]2[C@H]1C(=O)N[C@@H](CCC)C(OC(=O)C(F)(F)F)C(=O)NC1CC1 |
|
|
|
|
|
|
| 0000000b 00941800 80080400 48080e20 000c0045 0000c101 0000c102 00000800 00600108 000000a0 0000800c 40019000 00009000 008a0080 00081080 302ec40c 00220028 00000000 b0400200 80200008 80004080 154828d0 23800040 04000214 00020000 00000000 02000200 2ca14230 00000208 00460000 c0080000 000080c4 | 10018002 01807400 00100b00 94010f10 000800c0 00100010 0000c00c 20003409 11000000 000101a0 01290000 4001f000 0e00801a 01112001 809a1408 000c110c 18860000 82000103 02402010 00001205 80000120 300f8e30 33004003 0250001c 00141400 00000000 08880000 90000005 08000204 01060813 a4024000 82002600 |