On Target NS3_HCV1B 0.2086331/CHEMBL3125634
For the given ligand Penciclovir, we have found in our database that, being scored 0.2086331, the most similar ligand is CHEMBL3125634. Check out the elaboration below.
| Penciclovir (Given Ligand) | CHEMBL3125634 (Similar Ligand) |
|---|---|
| Nc2nc(=O)c1ncn(CCC(CO)CO)c1[nH]2 | CC(C)(C)NC(=O)Nc1nc(Cl)c(CCC2CCCCC2)n(CC(=O)Nc2ccccc2C(=O)NS(=O)(=O)c2ccc(C(F)(F)F)cc2)c1=O |
|
|
|
|
|
|
| 0000000a 00801800 00080000 00000600 00180040 0000c040 0000b004 00000800 06400100 800000e0 0000800c 40011000 00009000 00c00000 00080080 100c000c 00000000 00008000 09400000 00200001 80000100 1c000050 21800840 00700014 00000000 80200000 60000000 00040000 00004008 00461000 c0080000 80000280 | 1001403a 05801800 011815e2 51b50e30 0408014c 08016040 0500ac05 00883101 16e00a01 f0083af0 08b8a06c 6010b980 05088808 03700801 80a309c2 08140004 8e246080 46504000 8a402408 00a06003 e0120580 78238700 21026800 0860041e 17048802 c1000704 48000410 900010ac 08048c1e 20c61811 803e2000 600383e8 |