On Target PA_INFA 0.16033755/CHEMBL2040578
For the given ligand Tenofovir disoproxil, we have found in our database that, being scored 0.16033755, the most similar ligand is CHEMBL2040578. Check out the elaboration below.
| Tenofovir disoproxil (Given Ligand) | CHEMBL2040578 (Similar Ligand) |
|---|---|
| CC(C)OC(=O)OCOP(=O)(CO[C@H](C)Cn2cnc1c(N)ncnc12)OCOC(=O)OC(C)C | CC(NC(=O)c1nc(-c2cnccn2)[nH]c(=O)c1O)c1ccccc1 |
|
|
|
|
|
|
| 0000000b 00941800 80080400 48080e20 000c0045 0000c101 0000c102 00000800 00600108 000000a0 0000800c 40019000 00009000 008a0080 00081080 302ec40c 00220028 00000000 b0400200 80200008 80004080 154828d0 23800040 04000214 00020000 00000000 02000200 2ca14230 00000208 00460000 c0080000 000080c4 | 00000202 00811808 40000100 10050e10 00000068 00124006 00c09800 0a003405 16000100 40180860 08290004 40048810 00008802 00708003 00820400 000c200c 08002068 1200b022 80c00000 10400000 80000000 48008600 21800040 4050011c 00044806 c0000680 28000030 80041004 0000410c 07660c03 c4048000 500006a0 |