On Target PR_HIV1 0.18965517/CHEMBL3645129
For the given ligand Tenofovir disoproxil, we have found in our database that, being scored 0.18965517, the most similar ligand is CHEMBL3645129. Check out the elaboration below.
| Tenofovir disoproxil (Given Ligand) | CHEMBL3645129 (Similar Ligand) |
|---|---|
| CC(C)OC(=O)OCOP(=O)(CO[C@H](C)Cn2cnc1c(N)ncnc12)OCOC(=O)OC(C)C | CC(C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)OC1CC2OCO[C@@H]2C1)S(=O)(=O)c1ccc(CO)cc1 |
|
|
|
|
|
|
| 0000000b 00941800 80080400 48080e20 000c0045 0000c101 0000c102 00000800 00600108 000000a0 0000800c 40019000 00009000 008a0080 00081080 302ec40c 00220028 00000000 b0400200 80200008 80004080 154828d0 23800040 04000214 00020000 00000000 02000200 2ca14230 00000208 00460000 c0080000 000080c4 | 00000010 01c05400 01100102 01b10700 00280088 0002c004 00000800 a8000004 00740b00 014809e0 08302000 60018000 00008002 02200101 80e80000 003a0008 10822000 02080000 11408800 01007603 80000100 18380cb0 07100040 d9500058 02000000 8000100e 00000000 3420002c 04000600 2106001b c0a00000 00012670 |