On Target RT_HIV1 0.235/CHEMBL4288759
For the given ligand Tenofovir disoproxil, we have found in our database that, being scored 0.235, the most similar ligand is CHEMBL4288759. Check out the elaboration below.
| Tenofovir disoproxil (Given Ligand) | CHEMBL4288759 (Similar Ligand) |
|---|---|
| CC(C)OC(=O)OCOP(=O)(CO[C@H](C)Cn2cnc1c(N)ncnc12)OCOC(=O)OC(C)C | O=c1nc(Nc2ccc(-c3cnc4ccccc4c3)cc2)c2cccnc2n1O |
|
|
|
|
|
|
| 0000000b 00941800 80080400 48080e20 000c0045 0000c101 0000c102 00000800 00600108 000000a0 0000800c 40019000 00009000 008a0080 00081080 302ec40c 00220028 00000000 b0400200 80200008 80004080 154828d0 23800040 04000214 00020000 00000000 02000200 2ca14230 00000208 00460000 c0080000 000080c4 | 01002002 00c00800 00084100 48090610 00041000 04004108 00009010 40000800 04002100 00000860 04300004 40049000 04008800 00c080c0 003000c0 900c0014 00060040 12014004 0c60000a 10200002 40802000 08078068 30804040 80c00004 00040001 c0080000 2a008280 000000e0 0040c008 00460000 c0040000 800000c0 |