On Target RT_HIV1 0.37797618/CHEMBL3683705
For the given ligand Grazoprevir, we have found in our database that, being scored 0.37797618, the most similar ligand is CHEMBL3683705. Check out the elaboration below.
| Grazoprevir (Given Ligand) | CHEMBL3683705 (Similar Ligand) |
|---|---|
| C=C[C@@H]1C[C@]1(NC(=O)[C@@H]2C[C@@H]6CN2C(=O)[C@H](C(C)(C)C)NC(=O)O[C@@H]3C[C@H]3CCCCCc5nc4ccc(OC)cc4nc5O6)C(=O)NS(=O)(=O)C7CC7 | COC(=O)N[C@H](C(=O)NCC(F)(F)CC[C@@H](CO)N(Cc1cn[nH]c1)S(=O)(=O)c1ccc2ncsc2c1)C(c1ccccc1)c1ccccc1 |
|
|
|
|
|
|
| 0405208a 0f407018 6010050a 15b10710 801c11e0 86018114 070aa003 a0609608 10c10a00 005888c8 0024a404 4085b040 0e00c816 09c42903 f1de1541 021ea00c 1aa24000 260a8104 40e12c18 00064201 40120040 bc148e30 33a00083 32148438 02042401 40001002 08808200 902000ad 0c000306 80864883 a4064000 25212a70 | 0003001a 5d803208 21100188 05b10610 000c1080 0001a0c0 04004801 2100900c 00c40a80 804818c0 08302a04 7001b000 0c20a022 00c42001 806024c0 001e140c 10022020 02080080 00602018 00226e01 c0000100 78240eb0 23900a01 db750058 02000800 ac000106 c0000020 d000002c 0c001680 2606000b a0004000 00412670 |