On Target NS5B_HCV1B 0.34615386/CHEMBL3645182
For the given ligand Asunaprevir, we have found in our database that, being scored 0.34615386, the most similar ligand is CHEMBL3645182. Check out the elaboration below.
| Asunaprevir (Given Ligand) | CHEMBL3645182 (Similar Ligand) |
|---|---|
| C=C[C@@H]1C[C@]1(NC(=O)[C@@H]4C[C@@H](Oc2ncc(OC)c3ccc(Cl)cc23)CN4C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)C(=O)NS(=O)(=O)C5CC5 | CNC(=O)c1c2cc(C3CC3)c(N(CCN3CCOCC3)S(C)(=O)=O)cc2nn1-c1ccc(Oc2ccc(F)cc2)cc1 |
|
|
|
|
|
|
| 0405a082 0d407018 60104108 05310702 80141080 02018114 160a0000 20201428 10810200 005088c8 00242404 4005b800 0e80c81e 09442003 b1581541 001ea00c 12224000 00080500 40e10810 00024201 40020040 bc148f38 33a00083 b2148038 02002401 00000002 00980200 9020802d 08000200 80060081 a4044000 07032a70 | 00004086 00805e08 2018092a c7310e00 010c1080 00004052 02060000 02001408 00100900 00090ac0 09312024 40118800 80008c23 01403201 811a1049 000ea10c 14268000 02000004 08602008 00624201 c0500101 3c838e38 32801800 a360003e 02104480 c0000040 00270080 8020108d 0c488304 0046804b c4048480 a31147e0 |