On Target NA_INFB 0.38864627/CHEMBL254883
For the given ligand Asunaprevir, we have found in our database that, being scored 0.38864627, the most similar ligand is CHEMBL254883. Check out the elaboration below.
| Asunaprevir (Given Ligand) | CHEMBL254883 (Similar Ligand) |
|---|---|
| C=C[C@@H]1C[C@]1(NC(=O)[C@@H]4C[C@@H](Oc2ncc(OC)c3ccc(Cl)cc23)CN4C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)C(=O)NS(=O)(=O)C5CC5 | C=CCO[C@@H](C=C)[C@H](NC(C)=O)[C@@H]1N[C@@H](C(=O)O)C[C@H]1/C=C\C |
|
|
|
|
|
|
| 0405a082 0d407018 60104108 05310702 80141080 02018114 160a0000 20201428 10810200 005088c8 00242404 4005b800 0e80c81e 09442003 b1581541 001ea00c 12224000 00080500 40e10810 00024201 40020040 bc148f38 33a00083 b2148038 02002401 00000002 00980200 9020802d 08000200 80060081 a4044000 07032a70 | 00050000 09007000 00100100 84010500 00080080 00000010 02080000 20000408 10000000 00108088 00200000 4001b000 0602801a 01882001 80181408 00081008 10a04000 00000040 40c02010 00000201 00000120 30040e30 13008081 02100018 00000401 00000000 00c04000 90000001 0c000202 00040401 24024000 00002210 |