On Target NA_INFB 0.34983498/CHEMBL4175983
For the given ligand Grazoprevir, we have found in our database that, being scored 0.34983498, the most similar ligand is CHEMBL4175983. Check out the elaboration below.
| Grazoprevir (Given Ligand) | CHEMBL4175983 (Similar Ligand) |
|---|---|
| C=C[C@@H]1C[C@]1(NC(=O)[C@@H]2C[C@@H]6CN2C(=O)[C@H](C(C)(C)C)NC(=O)O[C@@H]3C[C@H]3CCCCCc5nc4ccc(OC)cc4nc5O6)C(=O)NS(=O)(=O)C7CC7 | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NCc2ccc(N3CCCC3)cc2)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 0405208a 0f407018 6010050a 15b10710 801c11e0 86018114 070aa003 a0609608 10c10a00 005888c8 0024a404 4085b040 0e00c816 09c42903 f1de1541 021ea00c 1aa24000 260a8104 40e12c18 00064201 40120040 bc148e30 33a00083 32148438 02042401 40001002 08808200 902000ad 0c000306 80864883 a4064000 25212a70 | 00074042 09007800 00100100 84010700 20180080 00002810 02080180 3a00140a 11000000 001108c8 40200004 41019001 0402881a 0188a000 00021448 00081008 10a44000 02000060 68c12010 00000201 40100020 38048e80 33008080 02500018 10001401 c0001400 00c04000 90000081 0c008300 00060401 24060000 00800a10 |