On Target NP_HCoV-OC43 0.093023255/CHEMBL3233481
For the given ligand Tenofovir disoproxil, we have found in our database that, being scored 0.093023255, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Tenofovir disoproxil (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CC(C)OC(=O)OCOP(=O)(CO[C@H](C)Cn2cnc1c(N)ncnc12)OCOC(=O)OC(C)C | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 0000000b 00941800 80080400 48080e20 000c0045 0000c101 0000c102 00000800 00600108 000000a0 0000800c 40019000 00009000 008a0080 00081080 302ec40c 00220028 00000000 b0400200 80200008 80004080 154828d0 23800040 04000214 00020000 00000000 02000200 2ca14230 00000208 00460000 c0080000 000080c4 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |