On Target NP_HCoV-OC43 0.13993174/CHEMBL3233481
For the given ligand Voxilaprevir, we have found in our database that, being scored 0.13993174, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Voxilaprevir (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CC[C@@H]5[C@@H]4CN(C(=O)[C@H](C(C)(C)C)NC(=O)O[C@@H]1C[C@@H]1CCCCC(F)(F)c3nc2ccc(OC)cc2nc3O4)[C@@H]5C(=O)N[C@]7(C(=O)NS(=O)(=O)C6(C)CC6)C[C@H]7C(F)F | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 0405208a 0f407018 6010050a 15b11710 801c1de0 86018114 070aa803 a0609208 10c10a00 004888f0 0424a404 4085b040 0e00c816 09c42903 f1fe1141 021ea40c 1aaa0020 260a8104 00e02c18 00064201 50120040 bc148e30 33a00083 72168438 02042403 40001082 08808260 902000ad 0c000306 06864803 a0064000 25212a70 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |