On Target NP_HCoV-OC43 0.184/CHEMBL3233481
For the given ligand Penciclovir, we have found in our database that, being scored 0.184, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Penciclovir (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| Nc2nc(=O)c1ncn(CCC(CO)CO)c1[nH]2 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 0000000a 00801800 00080000 00000600 00180040 0000c040 0000b004 00000800 06400100 800000e0 0000800c 40011000 00009000 00c00000 00080080 100c000c 00000000 00008000 09400000 00200001 80000100 1c000050 21800840 00700014 00000000 80200000 60000000 00040000 00004008 00461000 c0080000 80000280 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |