On Target PLP_SARS 0.32362458/CHEMBL212080
For the given ligand Grazoprevir, we have found in our database that, being scored 0.32362458, the most similar ligand is CHEMBL212080. Check out the elaboration below.
| Grazoprevir (Given Ligand) | CHEMBL212080 (Similar Ligand) |
|---|---|
| C=C[C@@H]1C[C@]1(NC(=O)[C@@H]2C[C@@H]6CN2C(=O)[C@H](C(C)(C)C)NC(=O)O[C@@H]3C[C@H]3CCCCCc5nc4ccc(OC)cc4nc5O6)C(=O)NS(=O)(=O)C7CC7 | CCOC(=O)/C=C/[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)OC(C)(C)C |
|
|
|
|
|
|
| 0405208a 0f407018 6010050a 15b10710 801c11e0 86018114 070aa003 a0609608 10c10a00 005888c8 0024a404 4085b040 0e00c816 09c42903 f1de1541 021ea00c 1aa24000 260a8104 40e12c18 00064201 40120040 bc148e30 33a00083 32148438 02042401 40001002 08808200 902000ad 0c000306 80864883 a4064000 25212a70 | 01030000 0140f000 00100100 84010600 00040080 0023c810 02100080 28000408 01a00300 001088c0 40200000 4003b000 1e028002 00092001 80001408 021a0008 20220000 02080500 20812890 01001201 00002020 38040fb0 13008083 02500018 00001401 8800ac02 00c84800 90200120 08000200 00060001 ec004000 02802210 |